Products 3039566-90-7
CAS 3039566-90-7 is the registry number for Methyl 4-((2S,4S)-4-ethoxypiperidin-2-yl)benzoate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl 4-[(2S,4S)-4-ethoxypiperidin-2-yl]benzoate;hydrochloride (CAS 3039566-90-7) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: methyl 4-[(2S,4S)-4-ethoxypiperidin-2-yl]benzoate;hydrochloride. InChIKey: CYQMVXCWHQNPLK-IODNYQNNSA-N.
| Molecular formula | C15H22ClNO3 |
|---|---|
| Molecular weight | 299.79 g/mol |
| IUPAC name | methyl 4-[(2S,4S)-4-ethoxypiperidin-2-yl]benzoate;hydrochloride |
| InChIKey | CYQMVXCWHQNPLK-IODNYQNNSA-N |
| SMILES | CCO[C@H]1CCN[C@@H](C1)C2=CC=C(C=C2)C(=O)OC.Cl |
Computed by PubChem (NCBI)