Products 1229358-21-7

CAS 1229358-21-7 is the registry number for Otava-bb 7005968, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-benzyl-N-(3-chloro-2-hydroxypropyl)carbamate (CAS 1229358-21-7) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: tert-butyl N-benzyl-N-(3-chloro-2-hydroxypropyl)carbamate. InChIKey: HCHFVUYSXVENKM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO3
Molecular weight299.79 g/mol
IUPAC nametert-butyl N-benzyl-N-(3-chloro-2-hydroxypropyl)carbamate
InChIKeyHCHFVUYSXVENKM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(CC1=CC=CC=C1)CC(CCl)O

Computed by PubChem (NCBI)