Products 685565-09-7

CAS 685565-09-7 is the registry number for 4-(3-Piperidin-1-ylpropoxy)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

4-(3-piperidin-1-ylpropoxy)benzoic acid;hydrochloride (CAS 685565-09-7) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: 4-(3-piperidin-1-ylpropoxy)benzoic acid;hydrochloride. InChIKey: GTNXJNORCIPAAA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO3
Molecular weight299.79 g/mol
IUPAC name4-(3-piperidin-1-ylpropoxy)benzoic acid;hydrochloride
InChIKeyGTNXJNORCIPAAA-UHFFFAOYSA-N
SMILESC1CCN(CC1)CCCOC2=CC=C(C=C2)C(=O)O.Cl

Computed by PubChem (NCBI)