CAS 3040120-40-6 is the registry number for Neuraminidase-IN-19. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methoxy-N-[(E)-1-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]ethylideneamino]benzamide (CAS 3040120-40-6) is a chemical compound with the molecular formula C22H21N3O3S and a molecular weight of 407.5 g/mol. IUPAC name: 4-methoxy-N-[(E)-1-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]ethylideneamino]benzamide. InChIKey: KRQURQADMFYKEU-BUVRLJJBSA-N.
| Molecular formula | C22H21N3O3S |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | 4-methoxy-N-[(E)-1-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]ethylideneamino]benzamide |
| InChIKey | KRQURQADMFYKEU-BUVRLJJBSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=C(C=C1)OC)/C2=CC=C(C=C2)NC(=O)CC3=CC=CS3 |
Computed by PubChem (NCBI)