CAS 3040121-14-7 is the registry number for Boc-NHCH2-Ph-Py-NH2. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl N-[[4-(5-amino-2-pyridinyl)phenyl]methyl]carbamate (CAS 3040121-14-7) is a chemical compound with the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. IUPAC name: tert-butyl N-[[4-(5-amino-2-pyridinyl)phenyl]methyl]carbamate. InChIKey: XNPPYABDYSUJAY-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O2 |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | tert-butyl N-[[4-(5-amino-2-pyridinyl)phenyl]methyl]carbamate |
| InChIKey | XNPPYABDYSUJAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)