Products 3040121-15-8
CAS 3040121-15-8 is the registry number for Boc-NHCH2-Ph-pyrimidine-NH2. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl N-[[4-(5-aminopyrimidin-2-yl)phenyl]methyl]carbamate (CAS 3040121-15-8) is a chemical compound with the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. IUPAC name: tert-butyl N-[[4-(5-aminopyrimidin-2-yl)phenyl]methyl]carbamate. InChIKey: LHLIVZYBSXLYFL-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O2 |
|---|---|
| Molecular weight | 300.36 g/mol |
| IUPAC name | tert-butyl N-[[4-(5-aminopyrimidin-2-yl)phenyl]methyl]carbamate |
| InChIKey | LHLIVZYBSXLYFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C2=NC=C(C=N2)N |
Computed by PubChem (NCBI)
Synonyms:
Boc-NHCH2-Ph-pyrimidine-NH2, orb3134280