CAS 304018-03-9 is the registry number for 3-(4-Fluorobenzoyl)-4H,5H,6H-cyclopenta(b)thiophen-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(4-fluorophenyl)methanone (CAS 304018-03-9) is a chemical compound with the molecular formula C14H12FNOS and a molecular weight of 261.32 g/mol. IUPAC name: (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(4-fluorophenyl)methanone. InChIKey: OGSMKDODPGCQDT-UHFFFAOYSA-N.
| Molecular formula | C14H12FNOS |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(4-fluorophenyl)methanone |
| InChIKey | OGSMKDODPGCQDT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)C3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)