CAS 941167-85-7 appears in our catalog under these names: 5-(4-Fluorobenzoyl)-4H,5H,6H,7H-thieno(3,2-c)pyridine, 95%, 5-(4-Fluorobenzoyl)-4H,5H,6H,7H-thieno(3,2-c)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-(4-fluorophenyl)methanone (CAS 941167-85-7) is a chemical compound with the molecular formula C14H12FNOS and a molecular weight of 261.32 g/mol. IUPAC name: 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-(4-fluorophenyl)methanone. InChIKey: KVEXSAMNLYFZSY-UHFFFAOYSA-N.
| Molecular formula | C14H12FNOS |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-(4-fluorophenyl)methanone |
| InChIKey | KVEXSAMNLYFZSY-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)C(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)