CAS 3041166-70-2 is the registry number for CHD-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(3-fluoro-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one (CAS 3041166-70-2) is a chemical compound with the molecular formula C16H12FNO4 and a molecular weight of 301.27 g/mol. IUPAC name: (E)-1-(3-fluoro-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one. InChIKey: OFOOHWAJXHWPNV-FNORWQNLSA-N.
| Molecular formula | C16H12FNO4 |
|---|---|
| Molecular weight | 301.27 g/mol |
| IUPAC name | (E)-1-(3-fluoro-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
| InChIKey | OFOOHWAJXHWPNV-FNORWQNLSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)/C=C/C2=CC(=CC=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)