CAS 933742-90-6 is the registry number for 1-(4-Fluorophenyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylic acid (CAS 933742-90-6) is a chemical compound with the molecular formula C16H12FNO4 and a molecular weight of 301.27 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylic acid. InChIKey: YHVILACXPAMVGO-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO4 |
|---|---|
| Molecular weight | 301.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylic acid |
| InChIKey | YHVILACXPAMVGO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C(=O)N2C3=CC=C(C=C3)F)C(=O)O)C(=O)C1 |
Computed by PubChem (NCBI)