Products 30427-95-3
CAS 30427-95-3 is the registry number for 1-Bromo-4-(4-chlorophenoxy)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-4-(4-chlorophenoxy)benzene (CAS 30427-95-3) is a chemical compound with the molecular formula C12H8BrClO and a molecular weight of 283.55 g/mol. IUPAC name: 1-bromo-4-(4-chlorophenoxy)benzene. InChIKey: LYCPQRWCXNZZKX-UHFFFAOYSA-N.
| Molecular formula | C12H8BrClO |
|---|---|
| Molecular weight | 283.55 g/mol |
| IUPAC name | 1-bromo-4-(4-chlorophenoxy)benzene |
| InChIKey | LYCPQRWCXNZZKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)