Products 364354-02-9
CAS 364354-02-9 appears in our catalog under these names: 4-Bromo-2-chloro-1-phenoxybenzene, 95%, 4-Bromo-2-chloro-1-phenoxybenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
4-bromo-2-chloro-1-phenoxybenzene (CAS 364354-02-9) is a chemical compound with the molecular formula C12H8BrClO and a molecular weight of 283.55 g/mol. IUPAC name: 4-bromo-2-chloro-1-phenoxybenzene. InChIKey: SYOSXGYFVKALPE-UHFFFAOYSA-N.
| Molecular formula | C12H8BrClO |
|---|---|
| Molecular weight | 283.55 g/mol |
| IUPAC name | 4-bromo-2-chloro-1-phenoxybenzene |
| InChIKey | SYOSXGYFVKALPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)