CAS 30431-54-0 appears in our catalog under these names: Bis(3,4,6–trichloro–2–(pentyloxycarbonyl)phenyl) oxalate, Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] Oxalate, >98.0%(HPLC), Oxalic Acid Bis[2,4,5-trichloro-6-(pentyloxycarbonyl)phenyl] Ester, 97%, 97%, Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] oxalate, Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] oxalate, 98%+(HPLC),RG. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 5g, 25g, 500g, Get quote.
Bis(3,4,6-trichloro-2-pentoxycarbonylphenyl) oxalate (CAS 30431-54-0) is a chemical compound with the molecular formula C26H24Cl6O8 and a molecular weight of 677.2 g/mol. IUPAC name: bis(3,4,6-trichloro-2-pentoxycarbonylphenyl) oxalate. InChIKey: TZZLVFUOAYMTHA-UHFFFAOYSA-N.
| Molecular formula | C26H24Cl6O8 |
|---|---|
| Molecular weight | 677.2 g/mol |
| IUPAC name | bis(3,4,6-trichloro-2-pentoxycarbonylphenyl) oxalate |
| InChIKey | TZZLVFUOAYMTHA-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)C1=C(C(=CC(=C1Cl)Cl)Cl)OC(=O)C(=O)OC2=C(C(=C(C=C2Cl)Cl)Cl)C(=O)OCCCCC |
Computed by PubChem (NCBI)