CAS 75203-51-9 appears in our catalog under these names: Bis(2–carbopentyloxy–3,5,6–trichlorophenyl) oxalate, Bis(3,5,6-trichloro-2-n-pentyloxycarbonylphenyl) oxalate, 95, Bis(2-carbopentyloxy-3,5,6-trichlorophenyl) oxalate, Bis(2-carbo-pentoxy-3,5,6-trichlorophenyl)oxalate, 98%, 98%, Bis(3,5,6-trichloro-2-n-pentyloxycarbonylphenyl) oxalate, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 0,1kg, 0,25kg, 0,5kg, 1kg, 5kg.
Bis(2,3,5-trichloro-6-pentoxycarbonylphenyl) oxalate (CAS 75203-51-9) is a chemical compound with the molecular formula C26H24Cl6O8 and a molecular weight of 677.2 g/mol. IUPAC name: bis(2,3,5-trichloro-6-pentoxycarbonylphenyl) oxalate. InChIKey: PURKHUDOTFUVNG-UHFFFAOYSA-N.
| Molecular formula | C26H24Cl6O8 |
|---|---|
| Molecular weight | 677.2 g/mol |
| IUPAC name | bis(2,3,5-trichloro-6-pentoxycarbonylphenyl) oxalate |
| InChIKey | PURKHUDOTFUVNG-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)C1=C(C(=C(C=C1Cl)Cl)Cl)OC(=O)C(=O)OC2=C(C(=CC(=C2Cl)Cl)Cl)C(=O)OCCCCC |
Computed by PubChem (NCBI)