CAS 3043827-04-6 is the registry number for 2-(4-Chloro-2'-methyl-[1,1'-biphenyl]-2-yl)propan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[5-chloro-2-(2-methylphenyl)phenyl]propan-2-ol (CAS 3043827-04-6) is a chemical compound with the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. IUPAC name: 2-[5-chloro-2-(2-methylphenyl)phenyl]propan-2-ol. InChIKey: PMOMSDOLLYHCEO-UHFFFAOYSA-N.
| Molecular formula | C16H17ClO |
|---|---|
| Molecular weight | 260.76 g/mol |
| IUPAC name | 2-[5-chloro-2-(2-methylphenyl)phenyl]propan-2-ol |
| InChIKey | PMOMSDOLLYHCEO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C=C(C=C2)Cl)C(C)(C)O |
Computed by PubChem (NCBI)