CAS 3044-60-8 appears in our catalog under these names: Toxicarol isoflavone, Toxicarolisoflavone, Toxicarol isoflavone, 99.13%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
5-hydroxy-8,8-dimethyl-3-(2,4,5-trimethoxyphenyl)pyrano[2,3-h]chromen-4-one (CAS 3044-60-8) is a chemical compound with the molecular formula C23H22O7 and a molecular weight of 410.4 g/mol. IUPAC name: 5-hydroxy-8,8-dimethyl-3-(2,4,5-trimethoxyphenyl)pyrano[2,3-h]chromen-4-one. InChIKey: WNIRAQXHOVJVDB-UHFFFAOYSA-N.
| Molecular formula | C23H22O7 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 5-hydroxy-8,8-dimethyl-3-(2,4,5-trimethoxyphenyl)pyrano[2,3-h]chromen-4-one |
| InChIKey | WNIRAQXHOVJVDB-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C(C3=C2OC=C(C3=O)C4=CC(=C(C=C4OC)OC)OC)O)C |
Computed by PubChem (NCBI)