Products 861446-23-3
CAS 861446-23-3 appears in our catalog under these names: Resveratrol Impurity 17 (1-O-Levulinoyl Resveratrol Diacetate), 1-O-Levulinoyl Resveratrol Diacetate. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[3-acetyloxy-5-[(E)-2-(4-acetyloxyphenyl)ethenyl]phenyl] 4-oxopentanoate (CAS 861446-23-3) is a chemical compound with the molecular formula C23H22O7 and a molecular weight of 410.4 g/mol. IUPAC name: [3-acetyloxy-5-[(E)-2-(4-acetyloxyphenyl)ethenyl]phenyl] 4-oxopentanoate. InChIKey: MNLPGXAHAQDWEJ-AATRIKPKSA-N.
| Molecular formula | C23H22O7 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | [3-acetyloxy-5-[(E)-2-(4-acetyloxyphenyl)ethenyl]phenyl] 4-oxopentanoate |
| InChIKey | MNLPGXAHAQDWEJ-AATRIKPKSA-N |
| SMILES | CC(=O)CCC(=O)OC1=CC(=CC(=C1)OC(=O)C)/C=C/C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)