CAS 304453-52-9 appears in our catalog under these names: N-(4-Chloro-3-nitrophenyl)-n'-(4-chlorophenyl)urea, 95%, N-(4-Chloro-3-nitrophenyl)-N'-(4-chlorophenyl)urea, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
1-(4-chloro-3-nitrophenyl)-3-(4-chlorophenyl)urea (CAS 304453-52-9) is a chemical compound with the molecular formula C13H9Cl2N3O3 and a molecular weight of 326.13 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)-3-(4-chlorophenyl)urea. InChIKey: BVHYZWAMYFVJFH-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3O3 |
|---|---|
| Molecular weight | 326.13 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)-3-(4-chlorophenyl)urea |
| InChIKey | BVHYZWAMYFVJFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC(=C(C=C2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)