CAS 680212-53-7 is the registry number for 1-(4-Chloro-3-nitrophenyl)-3-(2-chlorophenyl)urea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chloro-3-nitrophenyl)-3-(2-chlorophenyl)urea (CAS 680212-53-7) is a chemical compound with the molecular formula C13H9Cl2N3O3 and a molecular weight of 326.13 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)-3-(2-chlorophenyl)urea. InChIKey: CFVUUXWNWGXXLW-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3O3 |
|---|---|
| Molecular weight | 326.13 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)-3-(2-chlorophenyl)urea |
| InChIKey | CFVUUXWNWGXXLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NC2=CC(=C(C=C2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)