CAS 304876-06-0 appears in our catalog under these names: 5-Bromo-3,3-diethyl-2,3-dihydro-1H-indol-2-one, 95%, 5-Bromo-3,3-diethyl-2,3-dihydro-1H-indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-bromo-3,3-diethyl-1H-indol-2-one (CAS 304876-06-0) is a chemical compound with the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. IUPAC name: 5-bromo-3,3-diethyl-1H-indol-2-one. InChIKey: QUXWTPUEQGPBEQ-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO |
|---|---|
| Molecular weight | 268.15 g/mol |
| IUPAC name | 5-bromo-3,3-diethyl-1H-indol-2-one |
| InChIKey | QUXWTPUEQGPBEQ-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(C=CC(=C2)Br)NC1=O)CC |
Computed by PubChem (NCBI)