Products 30494-98-5
CAS 30494-98-5 is the registry number for 2-(2-Phenyl-1,3-oxazol-4-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2-phenyl-1,3-oxazol-4-yl)acetonitrile (CAS 30494-98-5) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 2-(2-phenyl-1,3-oxazol-4-yl)acetonitrile. InChIKey: NLLYDPLGYXCDPO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-(2-phenyl-1,3-oxazol-4-yl)acetonitrile |
| InChIKey | NLLYDPLGYXCDPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)CC#N |
Computed by PubChem (NCBI)