Products 30511-77-4
CAS 30511-77-4 appears in our catalog under these names: Isochavicine, (2E,4Z)-5-(1,3-dioxaindan-5-yl)-1-(piperidin-1-yl)penta-2,4-dien-1-one, ≥90%, ≥90%, Isochavicine, 93.21%. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 50mg, 5mg, Get quote.
(2E,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one (CAS 30511-77-4) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: (2E,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one. InChIKey: MXXWOMGUGJBKIW-MFDSWNTHSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | (2E,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| InChIKey | MXXWOMGUGJBKIW-MFDSWNTHSA-N |
| SMILES | C1CCN(CC1)C(=O)/C=C/C=C\C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)