CAS 495-91-0 is the registry number for Chavicine. Offered by: TRC. Available pack sizes: 50mg.
(2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one (CAS 495-91-0) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: (2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one. InChIKey: MXXWOMGUGJBKIW-PORYWJCVSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | (2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| InChIKey | MXXWOMGUGJBKIW-PORYWJCVSA-N |
| SMILES | C1CCN(CC1)C(=O)/C=C\C=C/C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)