Products 3052628-93-7
CAS 3052628-93-7 is the registry number for (E)-N'-(3-(tert-butyl)benzylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[(E)-(3-tert-butylphenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 3052628-93-7) is a chemical compound with the molecular formula C18H22N2O2S and a molecular weight of 330.4 g/mol. IUPAC name: N-[(E)-(3-tert-butylphenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: RSYKCDASPITYNB-CPNJWEJPSA-N.
| Molecular formula | C18H22N2O2S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | N-[(E)-(3-tert-butylphenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | RSYKCDASPITYNB-CPNJWEJPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC(=CC=C2)C(C)(C)C |
Computed by PubChem (NCBI)