CAS 3055031-36-9 is the registry number for PKMYT1-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-4-(7-fluoro-1H-indazol-4-yl)-7,8-dimethyl-1H-1,5-naphthyridin-2-one (CAS 3055031-36-9) is a chemical compound with the molecular formula C17H14FN5O and a molecular weight of 323.32 g/mol. IUPAC name: 3-amino-4-(7-fluoro-1H-indazol-4-yl)-7,8-dimethyl-1H-1,5-naphthyridin-2-one. InChIKey: CFWJQQWLNIWVCH-UHFFFAOYSA-N.
| Molecular formula | C17H14FN5O |
|---|---|
| Molecular weight | 323.32 g/mol |
| IUPAC name | 3-amino-4-(7-fluoro-1H-indazol-4-yl)-7,8-dimethyl-1H-1,5-naphthyridin-2-one |
| InChIKey | CFWJQQWLNIWVCH-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=C(C(=O)NC2=C1C)N)C3=C4C=NNC4=C(C=C3)F |
Computed by PubChem (NCBI)