CAS 844435-10-5 is the registry number for AJI-100. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(4-anilino-5-fluoropyrimidin-2-yl)amino]benzamide (CAS 844435-10-5) is a chemical compound with the molecular formula C17H14FN5O and a molecular weight of 323.32 g/mol. IUPAC name: 4-[(4-anilino-5-fluoropyrimidin-2-yl)amino]benzamide. InChIKey: IBAUSYCHSXHDOA-UHFFFAOYSA-N.
| Molecular formula | C17H14FN5O |
|---|---|
| Molecular weight | 323.32 g/mol |
| IUPAC name | 4-[(4-anilino-5-fluoropyrimidin-2-yl)amino]benzamide |
| InChIKey | IBAUSYCHSXHDOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC=C2F)NC3=CC=C(C=C3)C(=O)N |
Computed by PubChem (NCBI)