CAS 3055550-22-3 is the registry number for EGFR-IN-86, 99.92%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg.
N-[2-(azetidin-1-ylsulfonyl)phenyl]-7-methyl-2-(3-methylpyrazol-1-yl)pyrrolo[2,3-d]pyrimidin-4-amine (CAS 3055550-22-3) is a chemical compound with the molecular formula C20H21N7O2S and a molecular weight of 423.5 g/mol. IUPAC name: N-[2-(azetidin-1-ylsulfonyl)phenyl]-7-methyl-2-(3-methylpyrazol-1-yl)pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: WDJPMSIMYPBJIU-UHFFFAOYSA-N.
| Molecular formula | C20H21N7O2S |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | N-[2-(azetidin-1-ylsulfonyl)phenyl]-7-methyl-2-(3-methylpyrazol-1-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | WDJPMSIMYPBJIU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1)C2=NC(=C3C=CN(C3=N2)C)NC4=CC=CC=C4S(=O)(=O)N5CCC5 |
Computed by PubChem (NCBI)