CAS 1797832-43-9 appears in our catalog under these names: Pazopanib Impurity 18, Pazopanib Impurity 15, N-demethyl Pazopanib (Positional Isomer), Pazopanib Impurity 6. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 200mg.
5-[[2-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-4-yl]amino]-2-methylbenzenesulfonamide (CAS 1797832-43-9) is a chemical compound with the molecular formula C20H21N7O2S and a molecular weight of 423.5 g/mol. IUPAC name: 5-[[2-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-4-yl]amino]-2-methylbenzenesulfonamide. InChIKey: KXEITTOLAUJQPU-UHFFFAOYSA-N.
| Molecular formula | C20H21N7O2S |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 5-[[2-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-4-yl]amino]-2-methylbenzenesulfonamide |
| InChIKey | KXEITTOLAUJQPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC(=NC=C2)NC3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N |
Computed by PubChem (NCBI)