CAS 444731-47-9 appears in our catalog under these names: VEGFR-2-IN-6, 98%, VEGFR–2–IN–6, VEGFR-2-IN-6, VEGFR-2-IN-6, 98%, 98%, VEGFR-2-IN-6, 99.89%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 25mg, 100mg, 50mg, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 5 mg.
2-methyl-5-[[4-[methyl-(3-methyl-2H-indazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide (CAS 444731-47-9) is a chemical compound with the molecular formula C20H21N7O2S and a molecular weight of 423.5 g/mol. IUPAC name: 2-methyl-5-[[4-[methyl-(3-methyl-2H-indazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide. InChIKey: BRBRXNGJZMGEHY-UHFFFAOYSA-N.
| Molecular formula | C20H21N7O2S |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 2-methyl-5-[[4-[methyl-(3-methyl-2H-indazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| InChIKey | BRBRXNGJZMGEHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NNC(=C4C=C3)C)S(=O)(=O)N |
Computed by PubChem (NCBI)