Products 3055817-53-0
CAS 3055817-53-0 is the registry number for tert-Butyl (6-(dimethylamino)spiro[3.3]heptan-2-yl)carbamate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-[2-(dimethylamino)spiro[3.3]heptan-6-yl]carbamate (CAS 3055817-53-0) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl N-[2-(dimethylamino)spiro[3.3]heptan-6-yl]carbamate. InChIKey: YOXQBQIQCFXMDC-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl N-[2-(dimethylamino)spiro[3.3]heptan-6-yl]carbamate |
| InChIKey | YOXQBQIQCFXMDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC2(C1)CC(C2)N(C)C |
Computed by PubChem (NCBI)