CAS 3058709-40-0 is the registry number for α-Synuclein modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2,6-trimethyl-7-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]pyrazolo[1,2-a]pyrazole-3,5-dione (CAS 3058709-40-0) is a chemical compound with the molecular formula C21H23N3O3 and a molecular weight of 365.4 g/mol. IUPAC name: 1,2,6-trimethyl-7-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]pyrazolo[1,2-a]pyrazole-3,5-dione. InChIKey: ASLRPOXFAYXDNS-RMKNXTFCSA-N.
| Molecular formula | C21H23N3O3 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1,2,6-trimethyl-7-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]pyrazolo[1,2-a]pyrazole-3,5-dione |
| InChIKey | ASLRPOXFAYXDNS-RMKNXTFCSA-N |
| SMILES | CC1=C(N2C(=C(C(=O)N2C1=O)C)/C=C/C3=CC=C(C=C3)N4CCOCC4)C |
Computed by PubChem (NCBI)