Products 3061-97-0
CAS 3061-97-0 is the registry number for (2S)-2-[(2R)-2-Amino-4-(methylsulfanyl)butanamido]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
(2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]propanoic acid (CAS 3061-97-0) is a chemical compound with the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. IUPAC name: (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]propanoic acid. InChIKey: JHKXZYLNVJRAAJ-NTSWFWBYSA-N.
| Molecular formula | C8H16N2O3S |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]propanoic acid |
| InChIKey | JHKXZYLNVJRAAJ-NTSWFWBYSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@@H](CCSC)N |
Computed by PubChem (NCBI)