Products 507456-54-4
CAS 507456-54-4 appears in our catalog under these names: 1-(1,1-Dioxidotetrahydrothiophen-3-yl)-1,3,3-trimethylurea 95%, 1-(1,1-Dioxidotetrahydrothiophen-3-yl)-1,3,3-trimethylurea, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(1,1-dioxothiolan-3-yl)-1,3,3-trimethylurea (CAS 507456-54-4) is a chemical compound with the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-1,3,3-trimethylurea. InChIKey: YBDUCJOFQJTISO-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O3S |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-1,3,3-trimethylurea |
| InChIKey | YBDUCJOFQJTISO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N(C)C1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)