Products 306296-71-9
CAS 306296-71-9 appears in our catalog under these names: tert-Butyl 4-hydroxy-2，6-dimethylbenzoate, 97%, 97%, tert-Butyl 4-hydroxy-2,6-dimethylbenzoate, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 4-hydroxy-2,6-dimethylbenzoate (CAS 306296-71-9) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl 4-hydroxy-2,6-dimethylbenzoate. InChIKey: DEURLQHZYGMLBV-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-2,6-dimethylbenzoate |
| InChIKey | DEURLQHZYGMLBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC(C)(C)C)C)O |
Computed by PubChem (NCBI)