CAS 306325-64-4 is the registry number for N-(4-bromo-3-chlorophenyl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(4-bromo-3-chlorophenyl)benzamide (CAS 306325-64-4) is a chemical compound with the molecular formula C13H9BrClNO and a molecular weight of 310.57 g/mol. IUPAC name: N-(4-bromo-3-chlorophenyl)benzamide. InChIKey: CPIZFOKFSNJTLB-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClNO |
|---|---|
| Molecular weight | 310.57 g/mol |
| IUPAC name | N-(4-bromo-3-chlorophenyl)benzamide |
| InChIKey | CPIZFOKFSNJTLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)