CAS 60773-49-1 appears in our catalog under these names: 2–Amino–5–bromo–2'–chlorobenzophenone, 2-Amino-5-bromo-2'-chlorobenzophenone, (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone 98%, (2-Amino-5-bromophenyl)(2-chlorophenyl)methanone, 98%, 98%, 2-Amino-5-bromo-2’-chlorobenzophenone, 98.81%. Offered by: GLPBio, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 10g, 5mg, 5000mg, 2000mg, 1g, 5g, 25g.
(2-amino-5-bromophenyl)-(2-chlorophenyl)methanone (CAS 60773-49-1) is a chemical compound with the molecular formula C13H9BrClNO and a molecular weight of 310.57 g/mol. IUPAC name: (2-amino-5-bromophenyl)-(2-chlorophenyl)methanone. InChIKey: GTLLBGFJGUJABH-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClNO |
|---|---|
| Molecular weight | 310.57 g/mol |
| IUPAC name | (2-amino-5-bromophenyl)-(2-chlorophenyl)methanone |
| InChIKey | GTLLBGFJGUJABH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Br)N)Cl |
Computed by PubChem (NCBI)