CAS 3064236-41-2 is the registry number for FCOB02. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(6-fluoro-3-pyridinyl)methoxy]-4-methylchromen-2-one (CAS 3064236-41-2) is a chemical compound with the molecular formula C16H12FNO3 and a molecular weight of 285.27 g/mol. IUPAC name: 7-[(6-fluoro-3-pyridinyl)methoxy]-4-methylchromen-2-one. InChIKey: XKOFLQZNSOSBJU-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO3 |
|---|---|
| Molecular weight | 285.27 g/mol |
| IUPAC name | 7-[(6-fluoro-3-pyridinyl)methoxy]-4-methylchromen-2-one |
| InChIKey | XKOFLQZNSOSBJU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC3=CN=C(C=C3)F |
Computed by PubChem (NCBI)