CAS 30651-23-1 is the registry number for 2,3'-Bipyridine, 1,1'-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-oxido-2-(1-oxidopyridin-1-ium-3-yl)pyridin-1-ium (CAS 30651-23-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 1-oxido-2-(1-oxidopyridin-1-ium-3-yl)pyridin-1-ium. InChIKey: SHNLJOWODFYYDR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1-oxido-2-(1-oxidopyridin-1-ium-3-yl)pyridin-1-ium |
| InChIKey | SHNLJOWODFYYDR-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+](C(=C1)C2=C[N+](=CC=C2)[O-])[O-] |
Computed by PubChem (NCBI)