CAS 3067184-99-7 is the registry number for STT3A/B-IN-1, 99.15%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg, 50 mg, 100 mg.
(3S)-1-[2-(1H-indol-2-yl)-4-(methylsulfonimidoyl)phenyl]pyrrolidin-3-ol (CAS 3067184-99-7) is a chemical compound with the molecular formula C19H21N3O2S and a molecular weight of 355.5 g/mol. IUPAC name: (3S)-1-[2-(1H-indol-2-yl)-4-(methylsulfonimidoyl)phenyl]pyrrolidin-3-ol. InChIKey: DXZQACFEAZEKNY-SXBQZSJRSA-N.
| Molecular formula | C19H21N3O2S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | (3S)-1-[2-(1H-indol-2-yl)-4-(methylsulfonimidoyl)phenyl]pyrrolidin-3-ol |
| InChIKey | DXZQACFEAZEKNY-SXBQZSJRSA-N |
| SMILES | C[S@](=N)(=O)C1=CC(=C(C=C1)N2CC[C@@H](C2)O)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)