CAS 882232-00-0 is the registry number for 2-[4-(4-Isopropyl-benzenesulfonyl)-phenyl]-5-methyl-2h-pyrazol-3-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-methyl-2-[4-(4-propan-2-ylphenyl)sulfonylphenyl]pyrazol-3-amine (CAS 882232-00-0) is a chemical compound with the molecular formula C19H21N3O2S and a molecular weight of 355.5 g/mol. IUPAC name: 5-methyl-2-[4-(4-propan-2-ylphenyl)sulfonylphenyl]pyrazol-3-amine. InChIKey: LWTOBJGUZAYEAH-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O2S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | 5-methyl-2-[4-(4-propan-2-ylphenyl)sulfonylphenyl]pyrazol-3-amine |
| InChIKey | LWTOBJGUZAYEAH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=CC=C(C=C2)S(=O)(=O)C3=CC=C(C=C3)C(C)C |
Computed by PubChem (NCBI)