CAS 3068-02-8 appears in our catalog under these names: Decahydro-2,6-naphthalenedicarboxylic acid dimethyl ester, 95%, Dimethyl Decahydro–2,6–naphthalenedicarboxylate, Dimethyl Decahydro-2,6-naphthalenedicarboxylate (mixture of isomers), >98.0%(GC), Decahydro-2,6-Naphthalenedicarboxylic Acid Dimethyl Ester, ≥98%(mixture of isomers), ≥98%(mixture of isomers). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg.
Dimethyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylate (CAS 3068-02-8) is a chemical compound with the molecular formula C14H22O4 and a molecular weight of 254.32 g/mol. IUPAC name: dimethyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylate. InChIKey: XYHMJVZAEWACCS-UHFFFAOYSA-N.
| Molecular formula | C14H22O4 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | dimethyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylate |
| InChIKey | XYHMJVZAEWACCS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2CC(CCC2C1)C(=O)OC |
Computed by PubChem (NCBI)