CAS 757965-01-8 appears in our catalog under these names: Oseltamivir Impurity 95, Ethyl (1S,5R,6R)-5-(pentan-3-yloxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1S,5R,6R)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 757965-01-8) is a chemical compound with the molecular formula C14H22O4 and a molecular weight of 254.32 g/mol. IUPAC name: ethyl (1S,5R,6R)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: XZXCGRFGEVXWIT-AGIUHOORSA-N.
| Molecular formula | C14H22O4 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | ethyl (1S,5R,6R)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | XZXCGRFGEVXWIT-AGIUHOORSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@H]2[C@H]1O2)C(=O)OCC |
Computed by PubChem (NCBI)