CAS 306935-54-6 appears in our catalog under these names: 6-Chloro-2H-chromene-3-carbonyl chloride, 97%, 6-Chloro-2H-chromene-3-carbonyl chloride, 95% . Offered by: Chemat Brand, Thermo Scientific. Available pack sizes: on request, 1g, 10g.
6-chloro-2H-chromene-3-carbonyl chloride (CAS 306935-54-6) is a chemical compound with the molecular formula C10H6Cl2O2 and a molecular weight of 229.06 g/mol. IUPAC name: 6-chloro-2H-chromene-3-carbonyl chloride. InChIKey: HGFGWTNRUGRBNQ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O2 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 6-chloro-2H-chromene-3-carbonyl chloride |
| InChIKey | HGFGWTNRUGRBNQ-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C=CC(=C2)Cl)C(=O)Cl |
Computed by PubChem (NCBI)