CAS 72857-85-3 appears in our catalog under these names: 3,4-Dichloro-5-phenyl-2(5h)-furanone, 95%, 3,4-Dichloro-5-phenyl-2,5-dihydrofuran-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg.
3,4-dichloro-2-phenyl-2H-furan-5-one (CAS 72857-85-3) is a chemical compound with the molecular formula C10H6Cl2O2 and a molecular weight of 229.06 g/mol. IUPAC name: 3,4-dichloro-2-phenyl-2H-furan-5-one. InChIKey: DCZUHULHKRPPLT-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O2 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3,4-dichloro-2-phenyl-2H-furan-5-one |
| InChIKey | DCZUHULHKRPPLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=C(C(=O)O2)Cl)Cl |
Computed by PubChem (NCBI)