Products 307340-35-8

CAS 307340-35-8 is the registry number for 4-((3-((3-Chlorophenyl)carbamoyl)phenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[3-[(3-chlorophenyl)carbamoyl]anilino]-4-oxobutanoic acid (CAS 307340-35-8) is a chemical compound with the molecular formula C17H15ClN2O4 and a molecular weight of 346.8 g/mol. IUPAC name: 4-[3-[(3-chlorophenyl)carbamoyl]anilino]-4-oxobutanoic acid. InChIKey: PSCRNIQGBCBXPU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15ClN2O4
Molecular weight346.8 g/mol
IUPAC name4-[3-[(3-chlorophenyl)carbamoyl]anilino]-4-oxobutanoic acid
InChIKeyPSCRNIQGBCBXPU-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)NC(=O)CCC(=O)O)C(=O)NC2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)