CAS 70128-63-1 is the registry number for Flavopereirine Perchlorate. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium perchlorate (CAS 70128-63-1) is a chemical compound with the molecular formula C17H15ClN2O4 and a molecular weight of 346.8 g/mol. IUPAC name: 3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium perchlorate. InChIKey: SJFWLNAQONFVEY-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O4 |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | 3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium perchlorate |
| InChIKey | SJFWLNAQONFVEY-UHFFFAOYSA-N |
| SMILES | CCC1=C[N+]2=C(C=C1)C3=C(C=C2)C4=CC=CC=C4N3.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)