CAS 307496-26-0 appears in our catalog under these names: 2,4–DIFLUOROBENZYLZINC BROMIDE, 2,4-Difluorobenzylzinc bromide, 0.5M in THF, packaged under . Offered by: GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 50ml.
Bromozinc(1+);2,4-difluoro-1-methanidylbenzene (CAS 307496-26-0) is a chemical compound with the molecular formula C7H5BrF2Zn and a molecular weight of 272.4 g/mol. IUPAC name: bromozinc(1+);2,4-difluoro-1-methanidylbenzene. InChIKey: WPJAHFYOACWPNA-UHFFFAOYSA-M.
| Molecular formula | C7H5BrF2Zn |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | bromozinc(1+);2,4-difluoro-1-methanidylbenzene |
| InChIKey | WPJAHFYOACWPNA-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=C(C=C(C=C1)F)F.[Zn+]Br |
Computed by PubChem (NCBI)