Products 308796-30-7
CAS 308796-30-7 appears in our catalog under these names: 3,5-DIFLUOROBENZYLZINC BROMIDE, 0.5M, 3,5-Difluorobenzylzinc bromide 0.5 M in Tetrahydrofuran. Offered by: Sigma-Aldrich, Fluorochem. Available pack sizes: 50ML.
Bromozinc(1+);1,3-difluoro-5-methanidylbenzene (CAS 308796-30-7) is a chemical compound with the molecular formula C7H5BrF2Zn and a molecular weight of 272.4 g/mol. IUPAC name: bromozinc(1+);1,3-difluoro-5-methanidylbenzene. InChIKey: HUTYJRVTQJKGIO-UHFFFAOYSA-M.
| Molecular formula | C7H5BrF2Zn |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | bromozinc(1+);1,3-difluoro-5-methanidylbenzene |
| InChIKey | HUTYJRVTQJKGIO-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CC(=CC(=C1)F)F.[Zn+]Br |
Computed by PubChem (NCBI)