CAS 307511-84-8 appears in our catalog under these names: Ethyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate, 95%, Ethyl 2-Amino-4-(4-tert-butylphenyl)-3-thiophenecarboxylate. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 250mg, 1g, 10g.
Ethyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate (CAS 307511-84-8) is a chemical compound with the molecular formula C17H21NO2S and a molecular weight of 303.4 g/mol. IUPAC name: ethyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate. InChIKey: CVICNZAIGJEBRL-UHFFFAOYSA-N.
| Molecular formula | C17H21NO2S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate |
| InChIKey | CVICNZAIGJEBRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)C(C)(C)C)N |
Computed by PubChem (NCBI)