CAS 321704-17-0 is the registry number for N-Benzyl-2,3,5,6-tetramethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-benzyl-2,3,5,6-tetramethylbenzenesulfonamide (CAS 321704-17-0) is a chemical compound with the molecular formula C17H21NO2S and a molecular weight of 303.4 g/mol. IUPAC name: N-benzyl-2,3,5,6-tetramethylbenzenesulfonamide. InChIKey: NYBLXCSLTQEWGY-UHFFFAOYSA-N.
| Molecular formula | C17H21NO2S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | N-benzyl-2,3,5,6-tetramethylbenzenesulfonamide |
| InChIKey | NYBLXCSLTQEWGY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NCC2=CC=CC=C2)C)C |
Computed by PubChem (NCBI)